C11H21NO3 — CID 67085705
tert-butyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate (PubChem CID 67085705) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67085705 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)C1CO |
| InChI | InChI=1S/C11H21NO3/c1-8-5-6-12(9(8)7-13)10(14)15-11(2,3)4/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | FPUBEXOAVGKKCY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |