About tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate
tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate (PubChem CID 170139098) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate.
Analyze tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate (CID 170139098) is tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate is CC[C@@H]1[C@@H](C)CCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate?
The InChIKey is SCWVELQPXUVWBH-VHSXEESVSA-N. The full InChI is InChI=1S/C12H23NO2/c1-6-10-9(2)7-8-13(10)11(14)15-12(3,4)5/h9-10H,6-8H2,1-5H3/t9-,10+/m0/s1.
What are the key properties of tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate?
tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate has a molecular weight of 213.32 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,3S)-2-ethyl-3-methylpyrrolidine-1-carboxylate is sourced from PubChem (CID 170139098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).