C12H24N2O2 — CID 169255149
tert-butyl (2S,3R)-2-ethyl-3-methylpiperazine-1-carboxylate (PubChem CID 169255149) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-ethyl-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-ethyl-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 169255149 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | tert-butyl (2S,3R)-2-ethyl-3-methylpiperazine-1-carboxylate |
| SMILES | CC[C@H]1[C@@H](C)NCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-6-10-9(2)13-7-8-14(10)11(15)16-12(3,4)5/h9-10,13H,6-8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | RNBBKOJPTGQWGN-ZJUUUORDSA-N |
| XLogP | 1.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |