C11H21NO3 — CID 102785992
2-methylpropyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate (PubChem CID 102785992) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-methylpropyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate.
| Compound Name | 2-methylpropyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102785992 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-methylpropyl 2-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(C)C1CO |
| InChI | InChI=1S/C11H21NO3/c1-8(2)7-15-11(14)12-5-4-9(3)10(12)6-13/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | JXJUNGUZOAIJTJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |