C10H17NO2 — CID 102738013
cyclopropyl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone (PubChem CID 102738013) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is cyclopropyl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone.
| Compound Name | cyclopropyl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 102738013 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | cyclopropyl-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]methanone |
| SMILES | CC1CCN(C(=O)C2CC2)C1CO |
| InChI | InChI=1S/C10H17NO2/c1-7-4-5-11(9(7)6-12)10(13)8-2-3-8/h7-9,12H,2-6H2,1H3 |
| InChIKey | ZGELMNYEMRSVPI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |