C13H24N2O5 — CID 126608604
tert-butyl (4R)-4-methoxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 126608604) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is tert-butyl (4R)-4-methoxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-methoxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126608604 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | tert-butyl (4R)-4-methoxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CO[C@@H]1CC(C(=O)N(C)OC)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H24N2O5/c1-13(2,3)20-12(17)15-8-9(18-5)7-10(15)11(16)14(4)19-6/h9-10H,7-8H2,1-6H3/t9-,10?/m1/s1 |
| InChIKey | CIZDXIBTPXEIDI-YHMJZVADSA-N |
| XLogP | 1.03 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|