C31H36N2O4S — CID 90869090
tert-butyl 2-[methoxy(methyl)carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 90869090) has the molecular formula C31H36N2O4S and a molecular weight of 532.71 g/mol. Its IUPAC name is tert-butyl 2-[methoxy(methyl)carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[methoxy(methyl)carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90869090 |
| Molecular Formula | C31H36N2O4S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | tert-butyl 2-[methoxy(methyl)carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | CON(C)C(=O)C1CC(SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H36N2O4S/c1-30(2,3)37-29(35)33-22-26(21-27(33)28(34)32(4)36-5)38-31(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,26-27H,21-22H2,1-5H3 |
| InChIKey | VALQXQNDOJEHDC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|