C45H57N3O3S — CID 67754267
tert-butyl 2-[[[(2S,3S)-2-(4-tert-butylanilino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 67754267) has the molecular formula C45H57N3O3S and a molecular weight of 720.04 g/mol. Its IUPAC name is tert-butyl 2-[[[(2S,3S)-2-(4-tert-butylanilino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[(2S,3S)-2-(4-tert-butylanilino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67754267 |
| Molecular Formula | C45H57N3O3S |
| Molecular Weight | 720.04 g/mol |
| Exact Mass | 719.41 |
| IUPAC Name | tert-butyl 2-[[[(2S,3S)-2-(4-tert-butylanilino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | CC[C@H](C)[C@H](Nc1ccc(C(C)(C)C)cc1)C(=O)NCC1CC(SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C45H57N3O3S/c1-9-32(2)40(47-37-27-25-33(26-28-37)43(3,4)5)41(49)46-30-38-29-39(31-48(38)42(50)51-44(6,7)8)52-45(34-19-13-10-14-20-34,35-21-15-11-16-22-35)36-23-17-12-18-24-36/h10-28,32,38-40,47H,9,29-31H2,1-8H3,(H,46,49)/t32-,38?,39?,40-/m0/s1 |
| InChIKey | VXZQOYPOWHPBMC-LUUJKXMLSA-N |
| XLogP | 10.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.04 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|