C33H37N3O2S2 — CID 11592252
prop-2-enyl (2S,4S)-2-[(pyrrolidine-1-carbothioylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 11592252) has the molecular formula C33H37N3O2S2 and a molecular weight of 571.81 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[(pyrrolidine-1-carbothioylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[(pyrrolidine-1-carbothioylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11592252 |
| Molecular Formula | C33H37N3O2S2 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[(pyrrolidine-1-carbothioylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1CNC(=S)N1CCCC1 |
| InChI | InChI=1S/C33H37N3O2S2/c1-2-22-38-32(37)36-25-30(23-29(36)24-34-31(39)35-20-12-13-21-35)40-33(26-14-6-3-7-15-26,27-16-8-4-9-17-27)28-18-10-5-11-19-28/h2-11,14-19,29-30H,1,12-13,20-25H2,(H,34,39)/t29-,30-/m0/s1 |
| InChIKey | XTGYFOCQNZFXSX-KYJUHHDHSA-N |
| XLogP | 6.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|