C29H30N2O2S2 — CID 86750461
prop-2-enyl (2R,4S)-2-(2-amino-2-sulfanylideneethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 86750461) has the molecular formula C29H30N2O2S2 and a molecular weight of 502.71 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-2-(2-amino-2-sulfanylideneethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4S)-2-(2-amino-2-sulfanylideneethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86750461 |
| Molecular Formula | C29H30N2O2S2 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | prop-2-enyl (2R,4S)-2-(2-amino-2-sulfanylideneethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H]1CC(N)=S |
| InChI | InChI=1S/C29H30N2O2S2/c1-2-18-33-28(32)31-21-26(19-25(31)20-27(30)34)35-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h2-17,25-26H,1,18-21H2,(H2,30,34)/t25-,26+/m1/s1 |
| InChIKey | KYSZMFAGWXWHLZ-FTJBHMTQSA-N |
| XLogP | 6.15 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|