C33H33NO4S — CID 10721172
(4-methoxyphenyl)methyl (2S,4S)-2-(hydroxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 10721172) has the molecular formula C33H33NO4S and a molecular weight of 539.70 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-(hydroxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-(hydroxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10721172 |
| Molecular Formula | C33H33NO4S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-(hydroxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2C[C@@H](SC(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@H]2CO)cc1 |
| InChI | InChI=1S/C33H33NO4S/c1-37-30-19-17-25(18-20-30)24-38-32(36)34-22-31(21-29(34)23-35)39-33(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,29,31,35H,21-24H2,1H3/t29-,31-/m0/s1 |
| InChIKey | HOOXHKLDUCPVQW-SMCANUKXSA-N |
| XLogP | 6.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|