C39H37N3O4S — CID 10627949
(4-methoxyphenyl)methyl (2S,4S)-2-[(pyridine-3-carbonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 10627949) has the molecular formula C39H37N3O4S and a molecular weight of 643.81 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-[(pyridine-3-carbonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(pyridine-3-carbonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10627949 |
| Molecular Formula | C39H37N3O4S |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(pyridine-3-carbonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2C[C@@H](SC(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@H]2CNC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C39H37N3O4S/c1-45-35-21-19-29(20-22-35)28-46-38(44)42-27-36(24-34(42)26-41-37(43)30-12-11-23-40-25-30)47-39(31-13-5-2-6-14-31,32-15-7-3-8-16-32)33-17-9-4-10-18-33/h2-23,25,34,36H,24,26-28H2,1H3,(H,41,43)/t34-,36-/m0/s1 |
| InChIKey | MREXUVCTBBGQIQ-GIWKVKTRSA-N |
| XLogP | 7.32 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|