C42H42N2O6S — CID 10580598
(4-methoxyphenyl)methyl (2S,4S)-2-[[(4-methoxyphenyl)methoxycarbonylamino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 10580598) has the molecular formula C42H42N2O6S and a molecular weight of 702.87 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-[[(4-methoxyphenyl)methoxycarbonylamino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-[[(4-methoxyphenyl)methoxycarbonylamino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10580598 |
| Molecular Formula | C42H42N2O6S |
| Molecular Weight | 702.87 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-[[(4-methoxyphenyl)methoxycarbonylamino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)NC[C@@H]2C[C@H](SC(c3ccccc3)(c3ccccc3)c3ccccc3)CN2C(=O)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H42N2O6S/c1-47-37-22-18-31(19-23-37)29-49-40(45)43-27-36-26-39(28-44(36)41(46)50-30-32-20-24-38(48-2)25-21-32)51-42(33-12-6-3-7-13-33,34-14-8-4-9-15-34)35-16-10-5-11-17-35/h3-25,36,39H,26-30H2,1-2H3,(H,43,45)/t36-,39-/m0/s1 |
| InChIKey | QJYANQBHZFBKFW-VQIIKMDRSA-N |
| XLogP | 8.44 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.87 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|