C32H31NO3S — CID 139702002
(4-methoxyphenyl)methyl N-[(Z)-4-tritylsulfanylbut-3-enyl]carbamate (PubChem CID 139702002) has the molecular formula C32H31NO3S and a molecular weight of 509.67 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[(Z)-4-tritylsulfanylbut-3-enyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[(Z)-4-tritylsulfanylbut-3-enyl]carbamate |
|---|---|
| PubChem CID | 139702002 |
| Molecular Formula | C32H31NO3S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[(Z)-4-tritylsulfanylbut-3-enyl]carbamate |
| SMILES | COc1ccc(COC(=O)NCC/C=C\SC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H31NO3S/c1-35-30-21-19-26(20-22-30)25-36-31(34)33-23-11-12-24-37-32(27-13-5-2-6-14-27,28-15-7-3-8-16-28)29-17-9-4-10-18-29/h2-10,12-22,24H,11,23,25H2,1H3,(H,33,34)/b24-12- |
| InChIKey | RHBRMKYRBGFXIM-MSXFZWOLSA-N |
| XLogP | 7.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|