C18H18N2O3 — CID 57179451
(4-methoxyphenyl)methyl N-(1-cyano-1-phenylethyl)carbamate (PubChem CID 57179451) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-(1-cyano-1-phenylethyl)carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-(1-cyano-1-phenylethyl)carbamate |
|---|---|
| PubChem CID | 57179451 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (4-methoxyphenyl)methyl N-(1-cyano-1-phenylethyl)carbamate |
| SMILES | COc1ccc(COC(=O)NC(C)(C#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-18(13-19,15-6-4-3-5-7-15)20-17(21)23-12-14-8-10-16(22-2)11-9-14/h3-11H,12H2,1-2H3,(H,20,21) |
| InChIKey | YBHGTXKKHDSKCR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |