C13H15FN2O2 — CID 129412139
benzyl N-[(2R)-2-cyano-4-fluorobutan-2-yl]carbamate (PubChem CID 129412139) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is benzyl N-[(2R)-2-cyano-4-fluorobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-2-cyano-4-fluorobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 129412139 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | benzyl N-[(2R)-2-cyano-4-fluorobutan-2-yl]carbamate |
| SMILES | C[C@](C#N)(CCF)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15FN2O2/c1-13(10-15,7-8-14)16-12(17)18-9-11-5-3-2-4-6-11/h2-6H,7-9H2,1H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | AEDHKYKBURAJOP-CYBMUJFWSA-N |
| XLogP | 2.55 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |