C14H19F3N2O2 — CID 86724733
benzyl N-(1-amino-5,5,5-trifluoro-2-methylpentan-2-yl)carbamate (PubChem CID 86724733) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is benzyl N-(1-amino-5,5,5-trifluoro-2-methylpentan-2-yl)carbamate.
| Compound Name | benzyl N-(1-amino-5,5,5-trifluoro-2-methylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 86724733 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | benzyl N-(1-amino-5,5,5-trifluoro-2-methylpentan-2-yl)carbamate |
| SMILES | CC(CN)(CCC(F)(F)F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-13(10-18,7-8-14(15,16)17)19-12(20)21-9-11-5-3-2-4-6-11/h2-6H,7-10,18H2,1H3,(H,19,20) |
| InChIKey | HRFVDFLTPAPNFA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |