C13H14LiNO2 — CID 87939839
lithium benzyl N-(2-methylbut-3-yn-2-yl)carbamate (PubChem CID 87939839) has the molecular formula C13H14LiNO2 and a molecular weight of 223.20 g/mol. Its IUPAC name is lithium benzyl N-(2-methylbut-3-yn-2-yl)carbamate.
| Compound Name | lithium benzyl N-(2-methylbut-3-yn-2-yl)carbamate |
|---|---|
| PubChem CID | 87939839 |
| Molecular Formula | C13H14LiNO2 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | lithium benzyl N-(2-methylbut-3-yn-2-yl)carbamate |
| SMILES | [C-]#CC(C)(C)NC(=O)OCc1ccccc1.[Li+] |
| InChI | InChI=1S/C13H14NO2.Li/c1-4-13(2,3)14-12(15)16-10-11-8-6-5-7-9-11;/h5-9H,10H2,2-3H3,(H,14,15);/q-1;+1 |
| InChIKey | SBBHVWNXASPVMN-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|