C18H21NO3 — CID 11208783
benzyl N-[(2S,3R)-3-hydroxy-2-phenylbutan-2-yl]carbamate (PubChem CID 11208783) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-3-hydroxy-2-phenylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-3-hydroxy-2-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11208783 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | benzyl N-[(2S,3R)-3-hydroxy-2-phenylbutan-2-yl]carbamate |
| SMILES | C[C@@H](O)[C@@](C)(NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-14(20)18(2,16-11-7-4-8-12-16)19-17(21)22-13-15-9-5-3-6-10-15/h3-12,14,20H,13H2,1-2H3,(H,19,21)/t14-,18-/m1/s1 |
| InChIKey | KYZKSDGXCOKPNG-RDTXWAMCSA-N |
| XLogP | 3.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |