C17H26N2O2S — CID 118488455
benzyl N-[2-cyano-5-(trimethyl-λ4-sulfanyl)pentan-2-yl]carbamate (PubChem CID 118488455) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is benzyl N-[2-cyano-5-(trimethyl-λ4-sulfanyl)pentan-2-yl]carbamate.
| Compound Name | benzyl N-[2-cyano-5-(trimethyl-λ4-sulfanyl)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 118488455 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | benzyl N-[2-cyano-5-(trimethyl-λ4-sulfanyl)pentan-2-yl]carbamate |
| SMILES | CC(C#N)(CCCS(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2S/c1-17(14-18,11-8-12-22(2,3)4)19-16(20)21-13-15-9-6-5-7-10-15/h5-7,9-10H,8,11-13H2,1-4H3,(H,19,20) |
| InChIKey | BAIDTXXFZFQWHY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |