C16H25NO4 — CID 57386791
benzyl N-[5-(methoxymethoxy)-2-methylpentan-2-yl]carbamate (PubChem CID 57386791) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is benzyl N-[5-(methoxymethoxy)-2-methylpentan-2-yl]carbamate.
| Compound Name | benzyl N-[5-(methoxymethoxy)-2-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 57386791 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | benzyl N-[5-(methoxymethoxy)-2-methylpentan-2-yl]carbamate |
| SMILES | COCOCCCC(C)(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H25NO4/c1-16(2,10-7-11-20-13-19-3)17-15(18)21-12-14-8-5-4-6-9-14/h4-6,8-9H,7,10-13H2,1-3H3,(H,17,18) |
| InChIKey | IZSNDPQAPOULOZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|