C13H18N2O5 — CID 18643839
benzyl N-[(2S)-2-amino-3-(methoxymethoxy)propanoyl]carbamate (PubChem CID 18643839) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is benzyl N-[(2S)-2-amino-3-(methoxymethoxy)propanoyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-amino-3-(methoxymethoxy)propanoyl]carbamate |
|---|---|
| PubChem CID | 18643839 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | benzyl N-[(2S)-2-amino-3-(methoxymethoxy)propanoyl]carbamate |
| SMILES | COCOC[C@H](N)C(=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O5/c1-18-9-19-8-11(14)12(16)15-13(17)20-7-10-5-3-2-4-6-10/h2-6,11H,7-9,14H2,1H3,(H,15,16,17)/t11-/m0/s1 |
| InChIKey | HJIBIONRDJRHTJ-NSHDSACASA-N |
| XLogP | 0.39 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|