C24H34N4O9 — CID 70485700
bis(benzyl N-[(2S)-2-amino-3-hydroxybutanoyl]carbamate);hydrate (PubChem CID 70485700) has the molecular formula C24H34N4O9 and a molecular weight of 522.56 g/mol. Its IUPAC name is bis(benzyl N-[(2S)-2-amino-3-hydroxybutanoyl]carbamate);hydrate.
| Compound Name | bis(benzyl N-[(2S)-2-amino-3-hydroxybutanoyl]carbamate);hydrate |
|---|---|
| PubChem CID | 70485700 |
| Molecular Formula | C24H34N4O9 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | bis(benzyl N-[(2S)-2-amino-3-hydroxybutanoyl]carbamate);hydrate |
| SMILES | CC(O)[C@H](N)C(=O)NC(=O)OCc1ccccc1.CC(O)[C@H](N)C(=O)NC(=O)OCc1ccccc1.O |
| InChI | InChI=1S/2C12H16N2O4.H2O/c2*1-8(15)10(13)11(16)14-12(17)18-7-9-5-3-2-4-6-9;/h2*2-6,8,10,15H,7,13H2,1H3,(H,14,16,17);1H2/t2*8?,10-;/m00./s1 |
| InChIKey | FDYWOJMMERXUQH-AUAQLAAMSA-N |
| XLogP | -0.53 |
| TPSA | 234.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |