C29H40N4O6 — CID 123365033
benzyl N-[(2S)-2-[7-[[(2S)-1-oxo-1-(phenylmethoxycarbonylamino)propan-2-yl]amino]heptylamino]propanoyl]carbamate (PubChem CID 123365033) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is benzyl N-[(2S)-2-[7-[[(2S)-1-oxo-1-(phenylmethoxycarbonylamino)propan-2-yl]amino]heptylamino]propanoyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-[7-[[(2S)-1-oxo-1-(phenylmethoxycarbonylamino)propan-2-yl]amino]heptylamino]propanoyl]carbamate |
|---|---|
| PubChem CID | 123365033 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | benzyl N-[(2S)-2-[7-[[(2S)-1-oxo-1-(phenylmethoxycarbonylamino)propan-2-yl]amino]heptylamino]propanoyl]carbamate |
| SMILES | C[C@H](NCCCCCCCN[C@@H](C)C(=O)NC(=O)OCc1ccccc1)C(=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H40N4O6/c1-22(26(34)32-28(36)38-20-24-14-8-6-9-15-24)30-18-12-4-3-5-13-19-31-23(2)27(35)33-29(37)39-21-25-16-10-7-11-17-25/h6-11,14-17,22-23,30-31H,3-5,12-13,18-21H2,1-2H3,(H,32,34,36)(H,33,35,37)/t22-,23-/m0/s1 |
| InChIKey | XBNWQQZFCXTKBB-GOTSBHOMSA-N |
| XLogP | 3.80 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|