C18H25NO4 — CID 174482515
benzyl N-(2-cyclohexyl-3-hydroxybutanoyl)carbamate (PubChem CID 174482515) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is benzyl N-(2-cyclohexyl-3-hydroxybutanoyl)carbamate.
| Compound Name | benzyl N-(2-cyclohexyl-3-hydroxybutanoyl)carbamate |
|---|---|
| PubChem CID | 174482515 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | benzyl N-(2-cyclohexyl-3-hydroxybutanoyl)carbamate |
| SMILES | CC(O)C(C(=O)NC(=O)OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H25NO4/c1-13(20)16(15-10-6-3-7-11-15)17(21)19-18(22)23-12-14-8-4-2-5-9-14/h2,4-5,8-9,13,15-16,20H,3,6-7,10-12H2,1H3,(H,19,21,22) |
| InChIKey | BLTGVULLQBXRAY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |