C20H30N2O2 — CID 103393619
benzyl N-[3-[[(1R)-1-cyclohexylethyl]amino]cyclobutyl]carbamate (PubChem CID 103393619) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is benzyl N-[3-[[(1R)-1-cyclohexylethyl]amino]cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-[[(1R)-1-cyclohexylethyl]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393619 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | benzyl N-[3-[[(1R)-1-cyclohexylethyl]amino]cyclobutyl]carbamate |
| SMILES | C[C@@H](NC1CC(NC(=O)OCc2ccccc2)C1)C1CCCCC1 |
| InChI | InChI=1S/C20H30N2O2/c1-15(17-10-6-3-7-11-17)21-18-12-19(13-18)22-20(23)24-14-16-8-4-2-5-9-16/h2,4-5,8-9,15,17-19,21H,3,6-7,10-14H2,1H3,(H,22,23)/t15-,18?,19?/m1/s1 |
| InChIKey | YPGHJXHNMNBATJ-VNCLNFNDSA-N |
| XLogP | 4.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |