C11H16ClNO3 — CID 119032008
benzyl (2S,3S)-2-amino-3-hydroxybutanoate;hydrochloride (PubChem CID 119032008) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is benzyl (2S,3S)-2-amino-3-hydroxybutanoate;hydrochloride.
| Compound Name | benzyl (2S,3S)-2-amino-3-hydroxybutanoate;hydrochloride |
|---|---|
| PubChem CID | 119032008 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | benzyl (2S,3S)-2-amino-3-hydroxybutanoate;hydrochloride |
| SMILES | C[C@H](O)[C@H](N)C(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C11H15NO3.ClH/c1-8(13)10(12)11(14)15-7-9-5-3-2-4-6-9;/h2-6,8,10,13H,7,12H2,1H3;1H/t8-,10-;/m0./s1 |
| InChIKey | IDZGTFSDZJVMSD-GNAZCLTHSA-N |
| XLogP | 0.86 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |