C14H19NO6 — CID 67782455
acetic acid;(3R)-3-amino-2-methyl-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 67782455) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is acetic acid;(3R)-3-amino-2-methyl-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | acetic acid;(3R)-3-amino-2-methyl-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 67782455 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | acetic acid;(3R)-3-amino-2-methyl-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | CC(=O)O.CC(C(=O)O)[C@@H](N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H15NO4.C2H4O2/c1-8(11(14)15)10(13)12(16)17-7-9-5-3-2-4-6-9;1-2(3)4/h2-6,8,10H,7,13H2,1H3,(H,14,15);1H3,(H,3,4)/t8?,10-;/m1./s1 |
| InChIKey | AGKXXLUWISIJLJ-JDXSOMNQSA-N |
| XLogP | 0.87 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |