C12H16N2O3 — CID 174682682
(2S,3R)-2-amino-3-hydroxy-N-(2-phenylacetyl)butanamide (PubChem CID 174682682) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-N-(2-phenylacetyl)butanamide.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-N-(2-phenylacetyl)butanamide |
|---|---|
| PubChem CID | 174682682 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-N-(2-phenylacetyl)butanamide |
| SMILES | C[C@@H](O)[C@H](N)C(=O)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2O3/c1-8(15)11(13)12(17)14-10(16)7-9-5-3-2-4-6-9/h2-6,8,11,15H,7,13H2,1H3,(H,14,16,17)/t8-,11+/m1/s1 |
| InChIKey | TZTJQTUYOSRXKD-KCJUWKMLSA-N |
| XLogP | -0.42 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |