C14H18N2O6 — CID 18653902
acetic acid;(3S)-3-amino-4-oxo-4-[(2-phenylacetyl)amino]butanoic acid (PubChem CID 18653902) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is acetic acid;(3S)-3-amino-4-oxo-4-[(2-phenylacetyl)amino]butanoic acid.
| Compound Name | acetic acid;(3S)-3-amino-4-oxo-4-[(2-phenylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 18653902 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | acetic acid;(3S)-3-amino-4-oxo-4-[(2-phenylacetyl)amino]butanoic acid |
| SMILES | CC(=O)O.N[C@@H](CC(=O)O)C(=O)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14N2O4.C2H4O2/c13-9(7-11(16)17)12(18)14-10(15)6-8-4-2-1-3-5-8;1-2(3)4/h1-5,9H,6-7,13H2,(H,16,17)(H,14,15,18);1H3,(H,3,4)/t9-;/m0./s1 |
| InChIKey | GXNXFHRKDKRDNV-FVGYRXGTSA-N |
| XLogP | -0.24 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |