C15H20N4O5 — CID 118478029
(3R)-2-amino-3-hydroxy-N-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoylcarbamoyl]butanamide (PubChem CID 118478029) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is (3R)-2-amino-3-hydroxy-N-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoylcarbamoyl]butanamide.
| Compound Name | (3R)-2-amino-3-hydroxy-N-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoylcarbamoyl]butanamide |
|---|---|
| PubChem CID | 118478029 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3R)-2-amino-3-hydroxy-N-[[(2S)-1-oxo-3-phenylpropan-2-yl]carbamoylcarbamoyl]butanamide |
| SMILES | C[C@@H](O)C(N)C(=O)NC(=O)NC(=O)N[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H20N4O5/c1-9(21)12(16)13(22)18-15(24)19-14(23)17-11(8-20)7-10-5-3-2-4-6-10/h2-6,8-9,11-12,21H,7,16H2,1H3,(H3,17,18,19,22,23,24)/t9-,11+,12?/m1/s1 |
| InChIKey | RTJBEMLKAGFUQA-BVAQLPTGSA-N |
| XLogP | -0.96 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|