C18H20CuN2O2 — CID 173080162
2-amino-N-(1-oxo-3-phenylpropan-2-yl)-3-phenylpropanamide;copper (PubChem CID 173080162) has the molecular formula C18H20CuN2O2 and a molecular weight of 359.92 g/mol. Its IUPAC name is 2-amino-N-(1-oxo-3-phenylpropan-2-yl)-3-phenylpropanamide;copper.
| Compound Name | 2-amino-N-(1-oxo-3-phenylpropan-2-yl)-3-phenylpropanamide;copper |
|---|---|
| PubChem CID | 173080162 |
| Molecular Formula | C18H20CuN2O2 |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-amino-N-(1-oxo-3-phenylpropan-2-yl)-3-phenylpropanamide;copper |
| SMILES | NC(Cc1ccccc1)C(=O)NC(C=O)Cc1ccccc1.[Cu] |
| InChI | InChI=1S/C18H20N2O2.Cu/c19-17(12-15-9-5-2-6-10-15)18(22)20-16(13-21)11-14-7-3-1-4-8-14;/h1-10,13,16-17H,11-12,19H2,(H,20,22); |
| InChIKey | OZZNTQMLOMVTDN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|