C14H20N2O2S — CID 173062166
(2S)-2-amino-4-methylsulfanyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 173062166) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 173062166 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)N[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H20N2O2S/c1-19-8-7-13(15)14(18)16-12(10-17)9-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9,15H2,1H3,(H,16,18)/t12-,13-/m0/s1 |
| InChIKey | WMMZZHBVEIQING-STQMWFEESA-N |
| XLogP | 0.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|