C20H32N4O3S — CID 155937510
(2S)-2-amino-N-[(2S)-1-[[(2S)-6-amino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylsulfanylbutanamide (PubChem CID 155937510) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-[[(2S)-6-amino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1-[[(2S)-6-amino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 155937510 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-[[(2S)-6-amino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C=O)CCCCN |
| InChI | InChI=1S/C20H32N4O3S/c1-28-12-10-17(22)19(26)24-18(13-15-7-3-2-4-8-15)20(27)23-16(14-25)9-5-6-11-21/h2-4,7-8,14,16-18H,5-6,9-13,21-22H2,1H3,(H,23,27)(H,24,26)/t16-,17-,18-/m0/s1 |
| InChIKey | FCDOVZHJSKOIQH-BZSNNMDCSA-N |
| XLogP | 0.61 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|