C26H26N2O5 — CID 175897082
benzyl 3-[(2S)-2-amino-3-[[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]amino]-3-oxopropyl]benzoate (PubChem CID 175897082) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is benzyl 3-[(2S)-2-amino-3-[[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]amino]-3-oxopropyl]benzoate.
| Compound Name | benzyl 3-[(2S)-2-amino-3-[[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]amino]-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 175897082 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | benzyl 3-[(2S)-2-amino-3-[[(2S)-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]amino]-3-oxopropyl]benzoate |
| SMILES | N[C@@H](Cc1cccc(C(=O)OCc2ccccc2)c1)C(=O)N[C@H](C=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C26H26N2O5/c27-24(25(31)28-22(16-29)14-18-9-11-23(30)12-10-18)15-20-7-4-8-21(13-20)26(32)33-17-19-5-2-1-3-6-19/h1-13,16,22,24,30H,14-15,17,27H2,(H,28,31)/t22-,24-/m0/s1 |
| InChIKey | LGPSBZONWOMDMZ-UPVQGACJSA-N |
| XLogP | 2.55 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|