C18H26N4O4 — CID 123994187
(2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanamide (PubChem CID 123994187) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanamide.
| Compound Name | (2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 123994187 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@H](C=O)CC(N)=O |
| InChI | InChI=1S/C18H26N4O4/c1-11(2)16(18(26)21-13(10-23)9-15(20)24)22-17(25)14(19)8-12-6-4-3-5-7-12/h3-7,10-11,13-14,16H,8-9,19H2,1-2H3,(H2,20,24)(H,21,26)(H,22,25)/t13-,14-,16-/m0/s1 |
| InChIKey | WZZOXXGMKFTRHL-DZKIICNBSA-N |
| XLogP | -0.74 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|