C19H31NO7S — CID 67509059
benzyl N-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfonyl]-2-methylbutan-2-yl]carbamate (PubChem CID 67509059) has the molecular formula C19H31NO7S and a molecular weight of 417.52 g/mol. Its IUPAC name is benzyl N-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfonyl]-2-methylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfonyl]-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67509059 |
| Molecular Formula | C19H31NO7S |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | benzyl N-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfonyl]-2-methylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCS(=O)(=O)CCOCCOCCO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H31NO7S/c1-19(2,20-18(22)27-16-17-6-4-3-5-7-17)8-14-28(23,24)15-13-26-12-11-25-10-9-21/h3-7,21H,8-16H2,1-2H3,(H,20,22) |
| InChIKey | AUJLYBZNYZUMOS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|