C19H30N2O2 — CID 67310517
benzyl N-(2-methyl-5-piperidin-1-ylpentan-2-yl)carbamate (PubChem CID 67310517) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is benzyl N-(2-methyl-5-piperidin-1-ylpentan-2-yl)carbamate.
| Compound Name | benzyl N-(2-methyl-5-piperidin-1-ylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 67310517 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | benzyl N-(2-methyl-5-piperidin-1-ylpentan-2-yl)carbamate |
| SMILES | CC(C)(CCCN1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H30N2O2/c1-19(2,12-9-15-21-13-7-4-8-14-21)20-18(22)23-16-17-10-5-3-6-11-17/h3,5-6,10-11H,4,7-9,12-16H2,1-2H3,(H,20,22) |
| InChIKey | CYYZBTGWBHTTNV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |