C18H27NO2 — CID 106484232
benzyl 3-(azocan-1-yl)-2-methylpropanoate (PubChem CID 106484232) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is benzyl 3-(azocan-1-yl)-2-methylpropanoate.
| Compound Name | benzyl 3-(azocan-1-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 106484232 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | benzyl 3-(azocan-1-yl)-2-methylpropanoate |
| SMILES | CC(CN1CCCCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-16(14-19-12-8-3-2-4-9-13-19)18(20)21-15-17-10-6-5-7-11-17/h5-7,10-11,16H,2-4,8-9,12-15H2,1H3 |
| InChIKey | ZMKGOOOWWNSKNV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |