benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate

C16H24N2O2 — CID 106484459

IUPACbenzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate
SMILESCC(CN1CCN[C@H](C)C1)C(=O)OCc1ccccc1
InChIInChI=1S/C16H24N2O2/c1-13(10-18-9-8-17-14(2)11-18)16(19)20-12-15-6-4-3-5-7-15/h3-7,13-14,17H,8-12H2,1-2H3/t13?,14-/m1/s1
InChIKeyXBWIQKMKYRDDEV-ARLHGKGLSA-N
MW276.38 g/mol
LogP1.66
Rot. Bonds5

About benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate

benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate (PubChem CID 106484459) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate.

Molecular Properties

Compound Namebenzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate
PubChem CID106484459
Molecular FormulaC16H24N2O2
Molecular Weight276.38 g/mol
Exact Mass276.18
IUPAC Namebenzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate
SMILESCC(CN1CCN[C@H](C)C1)C(=O)OCc1ccccc1
InChIInChI=1S/C16H24N2O2/c1-13(10-18-9-8-17-14(2)11-18)16(19)20-12-15-6-4-3-5-7-15/h3-7,13-14,17H,8-12H2,1-2H3/t13?,14-/m1/s1
InChIKeyXBWIQKMKYRDDEV-ARLHGKGLSA-N
XLogP1.66
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.38
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate?
The IUPAC name of benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate (CID 106484459) is benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate.
What is the SMILES notation for benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate?
The canonical SMILES for benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate is CC(CN1CCN[C@H](C)C1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate?
The InChIKey is XBWIQKMKYRDDEV-ARLHGKGLSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-13(10-18-9-8-17-14(2)11-18)16(19)20-12-15-6-4-3-5-7-15/h3-7,13-14,17H,8-12H2,1-2H3/t13?,14-/m1/s1.
What are the key properties of benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate?
benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate has a molecular weight of 276.38 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-methyl-3-[(3R)-3-methylpiperazin-1-yl]propanoate is sourced from PubChem (CID 106484459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).