C15H28N2O6 — CID 11151722
oxalic acid;3-piperidin-1-ylpropyl N-tert-butylcarbamate (PubChem CID 11151722) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is oxalic acid;3-piperidin-1-ylpropyl N-tert-butylcarbamate.
| Compound Name | oxalic acid;3-piperidin-1-ylpropyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 11151722 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | oxalic acid;3-piperidin-1-ylpropyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCN1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H26N2O2.C2H2O4/c1-13(2,3)14-12(16)17-11-7-10-15-8-5-4-6-9-15;3-1(4)2(5)6/h4-11H2,1-3H3,(H,14,16);(H,3,4)(H,5,6) |
| InChIKey | FVSJDEMNSOUTHP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|