About 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate
3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate (PubChem CID 156847315) has the molecular formula C24H46N4O4
and a molecular weight of 454.66 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate.
Molecular Properties
| Compound Name | 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate |
| PubChem CID | 156847315 |
| Molecular Formula | C24H46N4O4 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate |
| SMILES | O=C(NCCCCCCNC(=O)OCCCN1CCCCC1)OCCCN1CCCCC1 |
| InChI | InChI=1S/C24H46N4O4/c29-23(31-21-11-19-27-15-7-3-8-16-27)25-13-5-1-2-6-14-26-24(30)32-22-12-20-28-17-9-4-10-18-28/h1-22H2,(H,25,29)(H,26,30) |
| InChIKey | GEAYHNCLISHHQN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
The IUPAC name of 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate (CID 156847315) is 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate.
What is the SMILES notation for 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
The canonical SMILES for 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate is O=C(NCCCCCCNC(=O)OCCCN1CCCCC1)OCCCN1CCCCC1.
What is the InChIKey of 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
The InChIKey is GEAYHNCLISHHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46N4O4/c29-23(31-21-11-19-27-15-7-3-8-16-27)25-13-5-1-2-6-14-26-24(30)32-22-12-20-28-17-9-4-10-18-28/h1-22H2,(H,25,29)(H,26,30).
What are the key properties of 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate has a molecular weight of 454.66 g/mol, XLogP of 3.75, 15 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylpropyl N-[6-(3-piperidin-1-ylpropoxycarbonylamino)hexyl]carbamate is sourced from PubChem (CID 156847315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).