C21H44Cl2N4O4 — CID 67933469
2-[2-(butylcarbamoyloxy)ethyl-(2-piperidin-1-ylethyl)amino]ethyl N-butylcarbamate;dihydrochloride (PubChem CID 67933469) has the molecular formula C21H44Cl2N4O4 and a molecular weight of 487.51 g/mol. Its IUPAC name is 2-[2-(butylcarbamoyloxy)ethyl-(2-piperidin-1-ylethyl)amino]ethyl N-butylcarbamate;dihydrochloride.
| Compound Name | 2-[2-(butylcarbamoyloxy)ethyl-(2-piperidin-1-ylethyl)amino]ethyl N-butylcarbamate;dihydrochloride |
|---|---|
| PubChem CID | 67933469 |
| Molecular Formula | C21H44Cl2N4O4 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 2-[2-(butylcarbamoyloxy)ethyl-(2-piperidin-1-ylethyl)amino]ethyl N-butylcarbamate;dihydrochloride |
| SMILES | CCCCNC(=O)OCCN(CCOC(=O)NCCCC)CCN1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C21H42N4O4.2ClH/c1-3-5-10-22-20(26)28-18-16-25(15-14-24-12-8-7-9-13-24)17-19-29-21(27)23-11-6-4-2;;/h3-19H2,1-2H3,(H,22,26)(H,23,27);2*1H |
| InChIKey | RROHBQWYAKRKMB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|