C18H37ClN4O6 — CID 88513482
methyl N-[2-[bis[2-(butylcarbamoyloxy)ethyl]amino]ethyl]carbamate;hydrochloride (PubChem CID 88513482) has the molecular formula C18H37ClN4O6 and a molecular weight of 440.97 g/mol. Its IUPAC name is methyl N-[2-[bis[2-(butylcarbamoyloxy)ethyl]amino]ethyl]carbamate;hydrochloride.
| Compound Name | methyl N-[2-[bis[2-(butylcarbamoyloxy)ethyl]amino]ethyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 88513482 |
| Molecular Formula | C18H37ClN4O6 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | methyl N-[2-[bis[2-(butylcarbamoyloxy)ethyl]amino]ethyl]carbamate;hydrochloride |
| SMILES | CCCCNC(=O)OCCN(CCNC(=O)OC)CCOC(=O)NCCCC.Cl |
| InChI | InChI=1S/C18H36N4O6.ClH/c1-4-6-8-19-17(24)27-14-12-22(11-10-21-16(23)26-3)13-15-28-18(25)20-9-7-5-2;/h4-15H2,1-3H3,(H,19,24)(H,20,25)(H,21,23);1H |
| InChIKey | KUAHYMWQTISJGW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|