About 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate
2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate (PubChem CID 59782278) has the molecular formula C28H58N4O4
and a molecular weight of 514.80 g/mol. Its IUPAC name is 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate.
Molecular Properties
| Compound Name | 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate |
| PubChem CID | 59782278 |
| Molecular Formula | C28H58N4O4 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.45 |
| IUPAC Name | 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate |
| SMILES | CCCCN(CCCC)CCOC(=O)NCCCCCCNC(=O)OCCN(CCCC)CCCC |
| InChI | InChI=1S/C28H58N4O4/c1-5-9-19-31(20-10-6-2)23-25-35-27(33)29-17-15-13-14-16-18-30-28(34)36-26-24-32(21-11-7-3)22-12-8-4/h5-26H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | PMUFLGNUXCEFGO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate?
The IUPAC name of 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate (CID 59782278) is 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate.
What is the SMILES notation for 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate?
The canonical SMILES for 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate is CCCCN(CCCC)CCOC(=O)NCCCCCCNC(=O)OCCN(CCCC)CCCC.
What is the InChIKey of 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate?
The InChIKey is PMUFLGNUXCEFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H58N4O4/c1-5-9-19-31(20-10-6-2)23-25-35-27(33)29-17-15-13-14-16-18-30-28(34)36-26-24-32(21-11-7-3)22-12-8-4/h5-26H2,1-4H3,(H,29,33)(H,30,34).
What are the key properties of 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate?
2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate has a molecular weight of 514.80 g/mol, XLogP of 5.80, 25 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)ethyl N-[6-[2-(dibutylamino)ethoxycarbonylamino]hexyl]carbamate is sourced from PubChem (CID 59782278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).