About 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine
2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine (PubChem CID 160828496) has the molecular formula C23H50N4O3
and a molecular weight of 430.68 g/mol. Its IUPAC name is 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine |
| PubChem CID | 160828496 |
| Molecular Formula | C23H50N4O3 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.39 |
| IUPAC Name | 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine |
| SMILES | CCCCC(=O)NCCCCCCNC(=O)OCCN(CC)CC.CCN(C)CC |
| InChI | InChI=1S/C18H37N3O3.C5H13N/c1-4-7-12-17(22)19-13-10-8-9-11-14-20-18(23)24-16-15-21(5-2)6-3;1-4-6(3)5-2/h4-16H2,1-3H3,(H,19,22)(H,20,23);4-5H2,1-3H3 |
| InChIKey | SGMLINZKFVDOJG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine?
The IUPAC name of 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine (CID 160828496) is 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine.
What is the SMILES notation for 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine?
The canonical SMILES for 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine is CCCCC(=O)NCCCCCCNC(=O)OCCN(CC)CC.CCN(C)CC.
What is the InChIKey of 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine?
The InChIKey is SGMLINZKFVDOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37N3O3.C5H13N/c1-4-7-12-17(22)19-13-10-8-9-11-14-20-18(23)24-16-15-21(5-2)6-3;1-4-6(3)5-2/h4-16H2,1-3H3,(H,19,22)(H,20,23);4-5H2,1-3H3.
What are the key properties of 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine?
2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine has a molecular weight of 430.68 g/mol, XLogP of 3.88, 17 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl N-[6-(pentanoylamino)hexyl]carbamate;N-ethyl-N-methylethanamine is sourced from PubChem (CID 160828496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).