About 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate
3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate (PubChem CID 156847303) has the molecular formula C22H42N4O4
and a molecular weight of 426.60 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate |
| PubChem CID | 156847303 |
| Molecular Formula | C22H42N4O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate |
| SMILES | O=C(NCCCCCCNC(=O)OCCCN1CCCC1)OCCCN1CCCC1 |
| InChI | InChI=1S/C22H42N4O4/c27-21(29-19-9-17-25-13-5-6-14-25)23-11-3-1-2-4-12-24-22(28)30-20-10-18-26-15-7-8-16-26/h1-20H2,(H,23,27)(H,24,28) |
| InChIKey | ONUFZRHFGSUYOA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
The IUPAC name of 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate (CID 156847303) is 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate.
What is the SMILES notation for 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
The canonical SMILES for 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate is O=C(NCCCCCCNC(=O)OCCCN1CCCC1)OCCCN1CCCC1.
What is the InChIKey of 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
The InChIKey is ONUFZRHFGSUYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42N4O4/c27-21(29-19-9-17-25-13-5-6-14-25)23-11-3-1-2-4-12-24-22(28)30-20-10-18-26-15-7-8-16-26/h1-20H2,(H,23,27)(H,24,28).
What are the key properties of 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate?
3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate has a molecular weight of 426.60 g/mol, XLogP of 2.97, 15 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-ylpropyl N-[6-(3-pyrrolidin-1-ylpropoxycarbonylamino)hexyl]carbamate is sourced from PubChem (CID 156847303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).