C23H38N2O6 — CID 10812933
6-(butylamino)-2-[3-(methoxymethoxy)propyl]-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 10812933) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is 6-(butylamino)-2-[3-(methoxymethoxy)propyl]-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 6-(butylamino)-2-[3-(methoxymethoxy)propyl]-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 10812933 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 6-(butylamino)-2-[3-(methoxymethoxy)propyl]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CCCCNCCCCC(CCCOCOC)(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H38N2O6/c1-3-4-15-24-16-9-8-13-23(21(26)27,14-10-17-30-19-29-2)25-22(28)31-18-20-11-6-5-7-12-20/h5-7,11-12,24H,3-4,8-10,13-19H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | ZCWXAWBVWPGKHO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|