C19H29NO5 — CID 102156455
[(2R)-2-(hydroxymethyl)-2-(phenylmethoxycarbonylamino)octyl] acetate (PubChem CID 102156455) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)-2-(phenylmethoxycarbonylamino)octyl] acetate.
| Compound Name | [(2R)-2-(hydroxymethyl)-2-(phenylmethoxycarbonylamino)octyl] acetate |
|---|---|
| PubChem CID | 102156455 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)-2-(phenylmethoxycarbonylamino)octyl] acetate |
| SMILES | CCCCCC[C@@](CO)(COC(C)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29NO5/c1-3-4-5-9-12-19(14-21,15-25-16(2)22)20-18(23)24-13-17-10-7-6-8-11-17/h6-8,10-11,21H,3-5,9,12-15H2,1-2H3,(H,20,23)/t19-/m1/s1 |
| InChIKey | XTCVGJZGJBJZBV-LJQANCHMSA-N |
| XLogP | 3.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|