C18H21NO4 — CID 102156454
benzyl N-(2-benzyl-1,3-dihydroxypropan-2-yl)carbamate (PubChem CID 102156454) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is benzyl N-(2-benzyl-1,3-dihydroxypropan-2-yl)carbamate.
| Compound Name | benzyl N-(2-benzyl-1,3-dihydroxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 102156454 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | benzyl N-(2-benzyl-1,3-dihydroxypropan-2-yl)carbamate |
| SMILES | O=C(NC(CO)(CO)Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H21NO4/c20-13-18(14-21,11-15-7-3-1-4-8-15)19-17(22)23-12-16-9-5-2-6-10-16/h1-10,20-21H,11-14H2,(H,19,22) |
| InChIKey | UPBYIRLVEHOLNI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |